C17H14ClNO4S — CID 11545071
5-chloro-3-(3,5-dimethoxyphenyl)sulfanyl-1H-indole-2-carboxylic acid (PubChem CID 11545071) has the molecular formula C17H14ClNO4S and a molecular weight of 363.82 g/mol. Its IUPAC name is 5-chloro-3-(3,5-dimethoxyphenyl)sulfanyl-1H-indole-2-carboxylic acid.
| Compound Name | 5-chloro-3-(3,5-dimethoxyphenyl)sulfanyl-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 11545071 |
| Molecular Formula | C17H14ClNO4S |
| Molecular Weight | 363.82 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | 5-chloro-3-(3,5-dimethoxyphenyl)sulfanyl-1H-indole-2-carboxylic acid |
| SMILES | COc1cc(OC)cc(Sc2c(C(=O)O)[nH]c3ccc(Cl)cc23)c1 |
| InChI | InChI=1S/C17H14ClNO4S/c1-22-10-6-11(23-2)8-12(7-10)24-16-13-5-9(18)3-4-14(13)19-15(16)17(20)21/h3-8,19H,1-2H3,(H,20,21) |
| InChIKey | AWVYLTMPQBJCJM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.82 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |