C23H19Cl2NO3S — CID 53469269
5-chloro-2-(4-chlorophenyl)-3-(3,4,5-trimethoxyphenyl)sulfanyl-1H-indole (PubChem CID 53469269) has the molecular formula C23H19Cl2NO3S and a molecular weight of 460.38 g/mol. Its IUPAC name is 5-chloro-2-(4-chlorophenyl)-3-(3,4,5-trimethoxyphenyl)sulfanyl-1H-indole.
| Compound Name | 5-chloro-2-(4-chlorophenyl)-3-(3,4,5-trimethoxyphenyl)sulfanyl-1H-indole |
|---|---|
| PubChem CID | 53469269 |
| Molecular Formula | C23H19Cl2NO3S |
| Molecular Weight | 460.38 g/mol |
| Exact Mass | 459.05 |
| IUPAC Name | 5-chloro-2-(4-chlorophenyl)-3-(3,4,5-trimethoxyphenyl)sulfanyl-1H-indole |
| SMILES | COc1cc(Sc2c(-c3ccc(Cl)cc3)[nH]c3ccc(Cl)cc23)cc(OC)c1OC |
| InChI | InChI=1S/C23H19Cl2NO3S/c1-27-19-11-16(12-20(28-2)22(19)29-3)30-23-17-10-15(25)8-9-18(17)26-21(23)13-4-6-14(24)7-5-13/h4-12,26H,1-3H3 |
| InChIKey | GIGZLJUUGYCIOR-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 43.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.38 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |