C24H22ClNO3 — CID 122183348
5-chloro-2-phenyl-3-[(3,4,5-trimethoxyphenyl)methyl]-1H-indole (PubChem CID 122183348) has the molecular formula C24H22ClNO3 and a molecular weight of 407.90 g/mol. Its IUPAC name is 5-chloro-2-phenyl-3-[(3,4,5-trimethoxyphenyl)methyl]-1H-indole.
| Compound Name | 5-chloro-2-phenyl-3-[(3,4,5-trimethoxyphenyl)methyl]-1H-indole |
|---|---|
| PubChem CID | 122183348 |
| Molecular Formula | C24H22ClNO3 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 5-chloro-2-phenyl-3-[(3,4,5-trimethoxyphenyl)methyl]-1H-indole |
| SMILES | COc1cc(Cc2c(-c3ccccc3)[nH]c3ccc(Cl)cc23)cc(OC)c1OC |
| InChI | InChI=1S/C24H22ClNO3/c1-27-21-12-15(13-22(28-2)24(21)29-3)11-19-18-14-17(25)9-10-20(18)26-23(19)16-7-5-4-6-8-16/h4-10,12-14,26H,11H2,1-3H3 |
| InChIKey | MWGGLRKYTPDHKC-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 43.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |