C22H24ClNO5 — CID 44597205
ethyl 5-chloro-3-[2-(3,4,5-trimethoxyphenyl)ethyl]-1H-indole-2-carboxylate (PubChem CID 44597205) has the molecular formula C22H24ClNO5 and a molecular weight of 417.89 g/mol. Its IUPAC name is ethyl 5-chloro-3-[2-(3,4,5-trimethoxyphenyl)ethyl]-1H-indole-2-carboxylate.
| Compound Name | ethyl 5-chloro-3-[2-(3,4,5-trimethoxyphenyl)ethyl]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 44597205 |
| Molecular Formula | C22H24ClNO5 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | ethyl 5-chloro-3-[2-(3,4,5-trimethoxyphenyl)ethyl]-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2ccc(Cl)cc2c1CCc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C22H24ClNO5/c1-5-29-22(25)20-15(16-12-14(23)7-9-17(16)24-20)8-6-13-10-18(26-2)21(28-4)19(11-13)27-3/h7,9-12,24H,5-6,8H2,1-4H3 |
| InChIKey | VWTZDQUBLAKTHA-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 69.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|