C16H21N3O3 — CID 15531146
ethyl 5-(acetamidomethyl)-3-(2-aminoethyl)-1H-indole-2-carboxylate (PubChem CID 15531146) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is ethyl 5-(acetamidomethyl)-3-(2-aminoethyl)-1H-indole-2-carboxylate.
| Compound Name | ethyl 5-(acetamidomethyl)-3-(2-aminoethyl)-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 15531146 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | ethyl 5-(acetamidomethyl)-3-(2-aminoethyl)-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2ccc(CNC(C)=O)cc2c1CCN |
| InChI | InChI=1S/C16H21N3O3/c1-3-22-16(21)15-12(6-7-17)13-8-11(9-18-10(2)20)4-5-14(13)19-15/h4-5,8,19H,3,6-7,9,17H2,1-2H3,(H,18,20) |
| InChIKey | JESKBCNOZWTEOH-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 97.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|