C18H18N2O3 — CID 94949097
ethyl 3-(aminomethyl)-5-phenoxy-1H-indole-2-carboxylate (PubChem CID 94949097) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is ethyl 3-(aminomethyl)-5-phenoxy-1H-indole-2-carboxylate.
| Compound Name | ethyl 3-(aminomethyl)-5-phenoxy-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 94949097 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | ethyl 3-(aminomethyl)-5-phenoxy-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2ccc(Oc3ccccc3)cc2c1CN |
| InChI | InChI=1S/C18H18N2O3/c1-2-22-18(21)17-15(11-19)14-10-13(8-9-16(14)20-17)23-12-6-4-3-5-7-12/h3-10,20H,2,11,19H2,1H3 |
| InChIKey | ZEWIAUKGIQAOIT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 77.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|