C22H26N3O3S+ — CID 23244765
[anilino(methylsulfanyl)methylidene]-[2-(2-ethoxycarbonyl-5-methoxy-1H-indol-3-yl)ethyl]azanium (PubChem CID 23244765) has the molecular formula C22H26N3O3S+ and a molecular weight of 412.54 g/mol. Its IUPAC name is [anilino(methylsulfanyl)methylidene]-[2-(2-ethoxycarbonyl-5-methoxy-1H-indol-3-yl)ethyl]azanium.
| Compound Name | [anilino(methylsulfanyl)methylidene]-[2-(2-ethoxycarbonyl-5-methoxy-1H-indol-3-yl)ethyl]azanium |
|---|---|
| PubChem CID | 23244765 |
| Molecular Formula | C22H26N3O3S+ |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | [anilino(methylsulfanyl)methylidene]-[2-(2-ethoxycarbonyl-5-methoxy-1H-indol-3-yl)ethyl]azanium |
| SMILES | CCOC(=O)c1[nH]c2ccc(OC)cc2c1CC/[NH+]=C(/Nc1ccccc1)SC |
| InChI | InChI=1S/C22H25N3O3S/c1-4-28-21(26)20-17(18-14-16(27-2)10-11-19(18)25-20)12-13-23-22(29-3)24-15-8-6-5-7-9-15/h5-11,14,25H,4,12-13H2,1-3H3,(H,23,24)/p+1 |
| InChIKey | NJAULGLTIJTDHK-UHFFFAOYSA-O |
| XLogP | 2.81 |
| TPSA | 77.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|