C25H17ClN2O7 — CID 90940249
5-chloro-3-[4-(5-methoxy-2-methyl-1H-indol-3-yl)-2,3,5,6-tetraoxocyclohexyl]-1H-indole-2-carboxylic acid (PubChem CID 90940249) has the molecular formula C25H17ClN2O7 and a molecular weight of 492.87 g/mol. Its IUPAC name is 5-chloro-3-[4-(5-methoxy-2-methyl-1H-indol-3-yl)-2,3,5,6-tetraoxocyclohexyl]-1H-indole-2-carboxylic acid.
| Compound Name | 5-chloro-3-[4-(5-methoxy-2-methyl-1H-indol-3-yl)-2,3,5,6-tetraoxocyclohexyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 90940249 |
| Molecular Formula | C25H17ClN2O7 |
| Molecular Weight | 492.87 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | 5-chloro-3-[4-(5-methoxy-2-methyl-1H-indol-3-yl)-2,3,5,6-tetraoxocyclohexyl]-1H-indole-2-carboxylic acid |
| SMILES | COc1ccc2[nH]c(C)c(C3C(=O)C(=O)C(c4c(C(=O)O)[nH]c5ccc(Cl)cc45)C(=O)C3=O)c2c1 |
| InChI | InChI=1S/C25H17ClN2O7/c1-9-16(13-8-11(35-2)4-6-14(13)27-9)18-21(29)23(31)19(24(32)22(18)30)17-12-7-10(26)3-5-15(12)28-20(17)25(33)34/h3-8,18-19,27-28H,1-2H3,(H,33,34) |
| InChIKey | QAXOLFUESNHWQN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 146.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.87 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|