C27H21ClN2O6 — CID 91255155
3-[4-(2-butyl-1H-indol-3-yl)-2,3,5,6-tetraoxocyclohexyl]-5-chloro-1H-indole-2-carboxylic acid (PubChem CID 91255155) has the molecular formula C27H21ClN2O6 and a molecular weight of 504.93 g/mol. Its IUPAC name is 3-[4-(2-butyl-1H-indol-3-yl)-2,3,5,6-tetraoxocyclohexyl]-5-chloro-1H-indole-2-carboxylic acid.
| Compound Name | 3-[4-(2-butyl-1H-indol-3-yl)-2,3,5,6-tetraoxocyclohexyl]-5-chloro-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 91255155 |
| Molecular Formula | C27H21ClN2O6 |
| Molecular Weight | 504.93 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | 3-[4-(2-butyl-1H-indol-3-yl)-2,3,5,6-tetraoxocyclohexyl]-5-chloro-1H-indole-2-carboxylic acid |
| SMILES | CCCCc1[nH]c2ccccc2c1C1C(=O)C(=O)C(c2c(C(=O)O)[nH]c3ccc(Cl)cc23)C(=O)C1=O |
| InChI | InChI=1S/C27H21ClN2O6/c1-2-3-7-17-18(13-6-4-5-8-15(13)29-17)20-23(31)25(33)21(26(34)24(20)32)19-14-11-12(28)9-10-16(14)30-22(19)27(35)36/h4-6,8-11,20-21,29-30H,2-3,7H2,1H3,(H,35,36) |
| InChIKey | IUZWNKMGEOPHCP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 137.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.93 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|