C26H20N2O6 — CID 57307773
3-[2,3,5,6-tetraoxo-4-(2-propyl-1H-indol-3-yl)cyclohexyl]-1H-indole-2-carboxylic acid (PubChem CID 57307773) has the molecular formula C26H20N2O6 and a molecular weight of 456.45 g/mol. Its IUPAC name is 3-[2,3,5,6-tetraoxo-4-(2-propyl-1H-indol-3-yl)cyclohexyl]-1H-indole-2-carboxylic acid.
| Compound Name | 3-[2,3,5,6-tetraoxo-4-(2-propyl-1H-indol-3-yl)cyclohexyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 57307773 |
| Molecular Formula | C26H20N2O6 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 3-[2,3,5,6-tetraoxo-4-(2-propyl-1H-indol-3-yl)cyclohexyl]-1H-indole-2-carboxylic acid |
| SMILES | CCCc1[nH]c2ccccc2c1C1C(=O)C(=O)C(c2c(C(=O)O)[nH]c3ccccc23)C(=O)C1=O |
| InChI | InChI=1S/C26H20N2O6/c1-2-7-16-17(12-8-3-5-10-14(12)27-16)19-22(29)24(31)20(25(32)23(19)30)18-13-9-4-6-11-15(13)28-21(18)26(33)34/h3-6,8-11,19-20,27-28H,2,7H2,1H3,(H,33,34) |
| InChIKey | GBCFOHJNASSFBW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 137.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|