C34H38N2O4 — CID 57020292
3,6-bis[2-(4-methylpentyl)-1H-indol-3-yl]cyclohexane-1,2,4,5-tetrone (PubChem CID 57020292) has the molecular formula C34H38N2O4 and a molecular weight of 538.69 g/mol. Its IUPAC name is 3,6-bis[2-(4-methylpentyl)-1H-indol-3-yl]cyclohexane-1,2,4,5-tetrone.
| Compound Name | 3,6-bis[2-(4-methylpentyl)-1H-indol-3-yl]cyclohexane-1,2,4,5-tetrone |
|---|---|
| PubChem CID | 57020292 |
| Molecular Formula | C34H38N2O4 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | 3,6-bis[2-(4-methylpentyl)-1H-indol-3-yl]cyclohexane-1,2,4,5-tetrone |
| SMILES | CC(C)CCCc1[nH]c2ccccc2c1C1C(=O)C(=O)C(c2c(CCCC(C)C)[nH]c3ccccc23)C(=O)C1=O |
| InChI | InChI=1S/C34H38N2O4/c1-19(2)11-9-17-25-27(21-13-5-7-15-23(21)35-25)29-31(37)33(39)30(34(40)32(29)38)28-22-14-6-8-16-24(22)36-26(28)18-10-12-20(3)4/h5-8,13-16,19-20,29-30,35-36H,9-12,17-18H2,1-4H3 |
| InChIKey | BRLLKOWMHMGJEI-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|