C17H15ClNO3P — CID 143230675
5-chloro-3-[methoxy-(3-methylphenyl)phosphanyl]-1H-indole-2-carboxylic acid (PubChem CID 143230675) has the molecular formula C17H15ClNO3P and a molecular weight of 347.74 g/mol. Its IUPAC name is 5-chloro-3-[methoxy-(3-methylphenyl)phosphanyl]-1H-indole-2-carboxylic acid.
| Compound Name | 5-chloro-3-[methoxy-(3-methylphenyl)phosphanyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 143230675 |
| Molecular Formula | C17H15ClNO3P |
| Molecular Weight | 347.74 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 5-chloro-3-[methoxy-(3-methylphenyl)phosphanyl]-1H-indole-2-carboxylic acid |
| SMILES | COP(c1cccc(C)c1)c1c(C(=O)O)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C17H15ClNO3P/c1-10-4-3-5-12(8-10)23(22-2)16-13-9-11(18)6-7-14(13)19-15(16)17(20)21/h3-9,19H,1-2H3,(H,20,21) |
| InChIKey | AAQZXNCYZYFNAI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.74 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|