C22H18ClFN3O2P — CID 143230600
5-chloro-3-[(3-fluorophenyl)-methoxyphosphanyl]-N-(pyridin-4-ylmethyl)-1H-indole-2-carboxamide (PubChem CID 143230600) has the molecular formula C22H18ClFN3O2P and a molecular weight of 441.83 g/mol. Its IUPAC name is 5-chloro-3-[(3-fluorophenyl)-methoxyphosphanyl]-N-(pyridin-4-ylmethyl)-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-3-[(3-fluorophenyl)-methoxyphosphanyl]-N-(pyridin-4-ylmethyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 143230600 |
| Molecular Formula | C22H18ClFN3O2P |
| Molecular Weight | 441.83 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | 5-chloro-3-[(3-fluorophenyl)-methoxyphosphanyl]-N-(pyridin-4-ylmethyl)-1H-indole-2-carboxamide |
| SMILES | COP(c1cccc(F)c1)c1c(C(=O)NCc2ccncc2)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C22H18ClFN3O2P/c1-29-30(17-4-2-3-16(24)12-17)21-18-11-15(23)5-6-19(18)27-20(21)22(28)26-13-14-7-9-25-10-8-14/h2-12,27H,13H2,1H3,(H,26,28) |
| InChIKey | UIGDNTZVJUCGMI-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.83 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|