C22H18ClF2N3O4P+ — CID 71012163
5-chloro-3-[(3,5-difluorophenyl)-methoxyphosphoryl]-N-[(1-hydroxypyridin-1-ium-4-yl)methyl]-1H-indole-2-carboxamide (PubChem CID 71012163) has the molecular formula C22H18ClF2N3O4P+ and a molecular weight of 492.83 g/mol. Its IUPAC name is 5-chloro-3-[(3,5-difluorophenyl)-methoxyphosphoryl]-N-[(1-hydroxypyridin-1-ium-4-yl)methyl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-3-[(3,5-difluorophenyl)-methoxyphosphoryl]-N-[(1-hydroxypyridin-1-ium-4-yl)methyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 71012163 |
| Molecular Formula | C22H18ClF2N3O4P+ |
| Molecular Weight | 492.83 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | 5-chloro-3-[(3,5-difluorophenyl)-methoxyphosphoryl]-N-[(1-hydroxypyridin-1-ium-4-yl)methyl]-1H-indole-2-carboxamide |
| SMILES | COP(=O)(c1cc(F)cc(F)c1)c1c(C(=O)NCc2cc[n+](O)cc2)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C22H17ClF2N3O4P/c1-32-33(31,17-10-15(24)9-16(25)11-17)21-18-8-14(23)2-3-19(18)27-20(21)22(29)26-12-13-4-6-28(30)7-5-13/h2-11H,12H2,1H3,(H2-,26,27,29,30,31)/p+1 |
| InChIKey | CSNJFGMIGRIICD-UHFFFAOYSA-O |
| XLogP | 3.43 |
| TPSA | 95.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.83 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|