C24H17ClF2N3O3P — CID 15959018
5-chloro-N-[(4-cyanophenyl)methyl]-3-[(3,5-difluorophenyl)-methoxyphosphoryl]-1H-indole-2-carboxamide (PubChem CID 15959018) has the molecular formula C24H17ClF2N3O3P and a molecular weight of 499.84 g/mol. Its IUPAC name is 5-chloro-N-[(4-cyanophenyl)methyl]-3-[(3,5-difluorophenyl)-methoxyphosphoryl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-N-[(4-cyanophenyl)methyl]-3-[(3,5-difluorophenyl)-methoxyphosphoryl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 15959018 |
| Molecular Formula | C24H17ClF2N3O3P |
| Molecular Weight | 499.84 g/mol |
| Exact Mass | 499.07 |
| IUPAC Name | 5-chloro-N-[(4-cyanophenyl)methyl]-3-[(3,5-difluorophenyl)-methoxyphosphoryl]-1H-indole-2-carboxamide |
| SMILES | COP(=O)(c1cc(F)cc(F)c1)c1c(C(=O)NCc2ccc(C#N)cc2)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C24H17ClF2N3O3P/c1-33-34(32,19-10-17(26)9-18(27)11-19)23-20-8-16(25)6-7-21(20)30-22(23)24(31)29-13-15-4-2-14(12-28)3-5-15/h2-11,30H,13H2,1H3,(H,29,31) |
| InChIKey | RESKVIXZONKLBN-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.84 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|