C25H23BrClN2O3P — CID 15959029
N-[(4-bromophenyl)methyl]-5-chloro-3-[(3,5-dimethylphenyl)-methoxyphosphoryl]-1H-indole-2-carboxamide (PubChem CID 15959029) has the molecular formula C25H23BrClN2O3P and a molecular weight of 545.80 g/mol. Its IUPAC name is N-[(4-bromophenyl)methyl]-5-chloro-3-[(3,5-dimethylphenyl)-methoxyphosphoryl]-1H-indole-2-carboxamide.
| Compound Name | N-[(4-bromophenyl)methyl]-5-chloro-3-[(3,5-dimethylphenyl)-methoxyphosphoryl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 15959029 |
| Molecular Formula | C25H23BrClN2O3P |
| Molecular Weight | 545.80 g/mol |
| Exact Mass | 544.03 |
| IUPAC Name | N-[(4-bromophenyl)methyl]-5-chloro-3-[(3,5-dimethylphenyl)-methoxyphosphoryl]-1H-indole-2-carboxamide |
| SMILES | COP(=O)(c1cc(C)cc(C)c1)c1c(C(=O)NCc2ccc(Br)cc2)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C25H23BrClN2O3P/c1-15-10-16(2)12-20(11-15)33(31,32-3)24-21-13-19(27)8-9-22(21)29-23(24)25(30)28-14-17-4-6-18(26)7-5-17/h4-13,29H,14H2,1-3H3,(H,28,30) |
| InChIKey | YSPDTYFIILEMFS-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.80 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|