C24H20ClN4O4P — CID 11634643
5-chloro-3-[(3-cyano-5-methylphenyl)-methoxyphosphoryl]-N-[(1-oxidopyridin-1-ium-4-yl)methyl]-1H-indole-2-carboxamide (PubChem CID 11634643) has the molecular formula C24H20ClN4O4P and a molecular weight of 494.88 g/mol. Its IUPAC name is 5-chloro-3-[(3-cyano-5-methylphenyl)-methoxyphosphoryl]-N-[(1-oxidopyridin-1-ium-4-yl)methyl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-3-[(3-cyano-5-methylphenyl)-methoxyphosphoryl]-N-[(1-oxidopyridin-1-ium-4-yl)methyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 11634643 |
| Molecular Formula | C24H20ClN4O4P |
| Molecular Weight | 494.88 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | 5-chloro-3-[(3-cyano-5-methylphenyl)-methoxyphosphoryl]-N-[(1-oxidopyridin-1-ium-4-yl)methyl]-1H-indole-2-carboxamide |
| SMILES | COP(=O)(c1cc(C)cc(C#N)c1)c1c(C(=O)NCc2cc[n+]([O-])cc2)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C24H20ClN4O4P/c1-15-9-17(13-26)11-19(10-15)34(32,33-2)23-20-12-18(25)3-4-21(20)28-22(23)24(30)27-14-16-5-7-29(31)8-6-16/h3-12,28H,14H2,1-2H3,(H,27,30) |
| InChIKey | VNJGJBSRRWUVSJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 121.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.88 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|