C26H25ClN4O4P+ — CID 71012241
5-chloro-3-[(3-cyano-5-propan-2-ylphenyl)-methoxyphosphoryl]-N-[(1-hydroxypyridin-1-ium-3-yl)methyl]-1H-indole-2-carboxamide (PubChem CID 71012241) has the molecular formula C26H25ClN4O4P+ and a molecular weight of 523.94 g/mol. Its IUPAC name is 5-chloro-3-[(3-cyano-5-propan-2-ylphenyl)-methoxyphosphoryl]-N-[(1-hydroxypyridin-1-ium-3-yl)methyl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-3-[(3-cyano-5-propan-2-ylphenyl)-methoxyphosphoryl]-N-[(1-hydroxypyridin-1-ium-3-yl)methyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 71012241 |
| Molecular Formula | C26H25ClN4O4P+ |
| Molecular Weight | 523.94 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | 5-chloro-3-[(3-cyano-5-propan-2-ylphenyl)-methoxyphosphoryl]-N-[(1-hydroxypyridin-1-ium-3-yl)methyl]-1H-indole-2-carboxamide |
| SMILES | COP(=O)(c1cc(C#N)cc(C(C)C)c1)c1c(C(=O)NCc2ccc[n+](O)c2)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C26H24ClN4O4P/c1-16(2)19-9-18(13-28)10-21(11-19)36(34,35-3)25-22-12-20(27)6-7-23(22)30-24(25)26(32)29-14-17-5-4-8-31(33)15-17/h4-12,15-16H,14H2,1-3H3,(H2-,29,30,32,33,34)/p+1 |
| InChIKey | KWXNVTUSHDAVBC-UHFFFAOYSA-O |
| XLogP | 4.15 |
| TPSA | 119.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.94 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|