C24H20Cl2N4O3P+ — CID 70822253
5-chloro-3-[(3-chloro-5-cyanophenyl)-methoxyphosphoryl]-N-[(1-methylpyridin-1-ium-3-yl)methyl]-1H-indole-2-carboxamide (PubChem CID 70822253) has the molecular formula C24H20Cl2N4O3P+ and a molecular weight of 514.33 g/mol. Its IUPAC name is 5-chloro-3-[(3-chloro-5-cyanophenyl)-methoxyphosphoryl]-N-[(1-methylpyridin-1-ium-3-yl)methyl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-3-[(3-chloro-5-cyanophenyl)-methoxyphosphoryl]-N-[(1-methylpyridin-1-ium-3-yl)methyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 70822253 |
| Molecular Formula | C24H20Cl2N4O3P+ |
| Molecular Weight | 514.33 g/mol |
| Exact Mass | 513.06 |
| IUPAC Name | 5-chloro-3-[(3-chloro-5-cyanophenyl)-methoxyphosphoryl]-N-[(1-methylpyridin-1-ium-3-yl)methyl]-1H-indole-2-carboxamide |
| SMILES | COP(=O)(c1cc(Cl)cc(C#N)c1)c1c(C(=O)NCc2ccc[n+](C)c2)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C24H19Cl2N4O3P/c1-30-7-3-4-15(14-30)13-28-24(31)22-23(20-11-17(25)5-6-21(20)29-22)34(32,33-2)19-9-16(12-27)8-18(26)10-19/h3-11,14H,13H2,1-2H3,(H-,28,29,31,32)/p+1 |
| InChIKey | CYZOFQKBUBYLGD-UHFFFAOYSA-O |
| XLogP | 3.98 |
| TPSA | 98.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.33 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|