C24H18ClN5O4P+ — CID 71012242
5-chloro-3-[(3,5-dicyanophenyl)-methoxyphosphoryl]-N-[(1-hydroxypyridin-1-ium-3-yl)methyl]-1H-indole-2-carboxamide (PubChem CID 71012242) has the molecular formula C24H18ClN5O4P+ and a molecular weight of 506.87 g/mol. Its IUPAC name is 5-chloro-3-[(3,5-dicyanophenyl)-methoxyphosphoryl]-N-[(1-hydroxypyridin-1-ium-3-yl)methyl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-3-[(3,5-dicyanophenyl)-methoxyphosphoryl]-N-[(1-hydroxypyridin-1-ium-3-yl)methyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 71012242 |
| Molecular Formula | C24H18ClN5O4P+ |
| Molecular Weight | 506.87 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | 5-chloro-3-[(3,5-dicyanophenyl)-methoxyphosphoryl]-N-[(1-hydroxypyridin-1-ium-3-yl)methyl]-1H-indole-2-carboxamide |
| SMILES | COP(=O)(c1cc(C#N)cc(C#N)c1)c1c(C(=O)NCc2ccc[n+](O)c2)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C24H17ClN5O4P/c1-34-35(33,19-8-16(11-26)7-17(9-19)12-27)23-20-10-18(25)4-5-21(20)29-22(23)24(31)28-13-15-3-2-6-30(32)14-15/h2-10,14H,13H2,1H3,(H2-,28,29,31,32,33)/p+1 |
| InChIKey | VETVDYSGGJEJAR-UHFFFAOYSA-O |
| XLogP | 2.89 |
| TPSA | 142.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.87 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|