C22H19ClN3O3P — CID 15958932
5-chloro-3-[methoxy(phenyl)phosphoryl]-N-(pyridin-4-ylmethyl)-1H-indole-2-carboxamide (PubChem CID 15958932) has the molecular formula C22H19ClN3O3P and a molecular weight of 439.84 g/mol. Its IUPAC name is 5-chloro-3-[methoxy(phenyl)phosphoryl]-N-(pyridin-4-ylmethyl)-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-3-[methoxy(phenyl)phosphoryl]-N-(pyridin-4-ylmethyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 15958932 |
| Molecular Formula | C22H19ClN3O3P |
| Molecular Weight | 439.84 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | 5-chloro-3-[methoxy(phenyl)phosphoryl]-N-(pyridin-4-ylmethyl)-1H-indole-2-carboxamide |
| SMILES | COP(=O)(c1ccccc1)c1c(C(=O)NCc2ccncc2)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C22H19ClN3O3P/c1-29-30(28,17-5-3-2-4-6-17)21-18-13-16(23)7-8-19(18)26-20(21)22(27)25-14-15-9-11-24-12-10-15/h2-13,26H,14H2,1H3,(H,25,27) |
| InChIKey | RHMNRAOFJMVFLM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.84 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|