C16H14ClN2O3P — CID 15958929
5-chloro-3-[methoxy(phenyl)phosphoryl]-1H-indole-2-carboxamide (PubChem CID 15958929) has the molecular formula C16H14ClN2O3P and a molecular weight of 348.73 g/mol. Its IUPAC name is 5-chloro-3-[methoxy(phenyl)phosphoryl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-3-[methoxy(phenyl)phosphoryl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 15958929 |
| Molecular Formula | C16H14ClN2O3P |
| Molecular Weight | 348.73 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 5-chloro-3-[methoxy(phenyl)phosphoryl]-1H-indole-2-carboxamide |
| SMILES | COP(=O)(c1ccccc1)c1c(C(N)=O)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C16H14ClN2O3P/c1-22-23(21,11-5-3-2-4-6-11)15-12-9-10(17)7-8-13(12)19-14(15)16(18)20/h2-9,19H,1H3,(H2,18,20) |
| InChIKey | NBMJEMWDMSGPCM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 85.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.73 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|