C20H17ClN3O2P — CID 58475166
5-chloro-3-[[3-[(E)-2-cyanoethenyl]-5-methylphenyl]-methylphosphoryl]-1H-indole-2-carboxamide (PubChem CID 58475166) has the molecular formula C20H17ClN3O2P and a molecular weight of 397.80 g/mol. Its IUPAC name is 5-chloro-3-[[3-[(E)-2-cyanoethenyl]-5-methylphenyl]-methylphosphoryl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-3-[[3-[(E)-2-cyanoethenyl]-5-methylphenyl]-methylphosphoryl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 58475166 |
| Molecular Formula | C20H17ClN3O2P |
| Molecular Weight | 397.80 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 5-chloro-3-[[3-[(E)-2-cyanoethenyl]-5-methylphenyl]-methylphosphoryl]-1H-indole-2-carboxamide |
| SMILES | Cc1cc(/C=C/C#N)cc(P(C)(=O)c2c(C(N)=O)[nH]c3ccc(Cl)cc23)c1 |
| InChI | InChI=1S/C20H17ClN3O2P/c1-12-8-13(4-3-7-22)10-15(9-12)27(2,26)19-16-11-14(21)5-6-17(16)24-18(19)20(23)25/h3-6,8-11,24H,1-2H3,(H2,23,25)/b4-3+ |
| InChIKey | GTFLLSZFONTTQO-ONEGZZNKSA-N |
| XLogP | 3.71 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.80 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|