C23H21ClN2O3P+ — CID 67259672
(5-chloro-2-ethoxycarbonyl-1H-indol-3-yl)-[3-(2-cyanoethenyl)-2-ethyl-5-methylphenyl]-oxophosphanium (PubChem CID 67259672) has the molecular formula C23H21ClN2O3P+ and a molecular weight of 439.86 g/mol. Its IUPAC name is (5-chloro-2-ethoxycarbonyl-1H-indol-3-yl)-[3-(2-cyanoethenyl)-2-ethyl-5-methylphenyl]-oxophosphanium.
| Compound Name | (5-chloro-2-ethoxycarbonyl-1H-indol-3-yl)-[3-(2-cyanoethenyl)-2-ethyl-5-methylphenyl]-oxophosphanium |
|---|---|
| PubChem CID | 67259672 |
| Molecular Formula | C23H21ClN2O3P+ |
| Molecular Weight | 439.86 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | (5-chloro-2-ethoxycarbonyl-1H-indol-3-yl)-[3-(2-cyanoethenyl)-2-ethyl-5-methylphenyl]-oxophosphanium |
| SMILES | CCOC(=O)c1[nH]c2ccc(Cl)cc2c1[P+](=O)c1cc(C)cc(C=CC#N)c1CC |
| InChI | InChI=1S/C23H20ClN2O3P/c1-4-17-15(7-6-10-25)11-14(3)12-20(17)30(28)22-18-13-16(24)8-9-19(18)26-21(22)23(27)29-5-2/h6-9,11-13H,4-5H2,1-3H3/p+1 |
| InChIKey | QXIBOAWCRCKDQX-UHFFFAOYSA-O |
| XLogP | 5.18 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.86 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|