C19H17Cl2NO2S — CID 127032350
ethyl 5-chloro-3-[(3-chlorophenyl)-methylsulfanylmethyl]-1H-indole-2-carboxylate (PubChem CID 127032350) has the molecular formula C19H17Cl2NO2S and a molecular weight of 394.32 g/mol. Its IUPAC name is ethyl 5-chloro-3-[(3-chlorophenyl)-methylsulfanylmethyl]-1H-indole-2-carboxylate.
| Compound Name | ethyl 5-chloro-3-[(3-chlorophenyl)-methylsulfanylmethyl]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 127032350 |
| Molecular Formula | C19H17Cl2NO2S |
| Molecular Weight | 394.32 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | ethyl 5-chloro-3-[(3-chlorophenyl)-methylsulfanylmethyl]-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2ccc(Cl)cc2c1C(SC)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H17Cl2NO2S/c1-3-24-19(23)17-16(14-10-13(21)7-8-15(14)22-17)18(25-2)11-5-4-6-12(20)9-11/h4-10,18,22H,3H2,1-2H3 |
| InChIKey | RJSRLBBSSBZDSG-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.32 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|