C15H14ClNO2 — CID 162435178
2-methylpropyl 5-chloro-3-ethynyl-1H-indole-2-carboxylate (PubChem CID 162435178) has the molecular formula C15H14ClNO2 and a molecular weight of 275.74 g/mol. Its IUPAC name is 2-methylpropyl 5-chloro-3-ethynyl-1H-indole-2-carboxylate.
| Compound Name | 2-methylpropyl 5-chloro-3-ethynyl-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 162435178 |
| Molecular Formula | C15H14ClNO2 |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 2-methylpropyl 5-chloro-3-ethynyl-1H-indole-2-carboxylate |
| SMILES | C#Cc1c(C(=O)OCC(C)C)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C15H14ClNO2/c1-4-11-12-7-10(16)5-6-13(12)17-14(11)15(18)19-8-9(2)3/h1,5-7,9,17H,8H2,2-3H3 |
| InChIKey | YCSYOZJXEKLJSE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|