C10H9ClIN2O3P — CID 88896255
5-chloro-3-[iodo(methoxy)phosphoryl]-1H-indole-2-carboxamide (PubChem CID 88896255) has the molecular formula C10H9ClIN2O3P and a molecular weight of 398.52 g/mol. Its IUPAC name is 5-chloro-3-[iodo(methoxy)phosphoryl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-3-[iodo(methoxy)phosphoryl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 88896255 |
| Molecular Formula | C10H9ClIN2O3P |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 397.91 |
| IUPAC Name | 5-chloro-3-[iodo(methoxy)phosphoryl]-1H-indole-2-carboxamide |
| SMILES | CO[P@](=O)(I)c1c(C(N)=O)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C10H9ClIN2O3P/c1-17-18(12,16)9-6-4-5(11)2-3-7(6)14-8(9)10(13)15/h2-4,14H,1H3,(H2,13,15)/t18-/m0/s1 |
| InChIKey | NGWOFNWLHFHSIX-SFHVURJKSA-N |
| XLogP | 2.82 |
| TPSA | 85.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|