C18H14ClN4O3P — CID 127032006
5-chloro-3-[[5-[(E)-2-cyanoethenyl]-3-pyridinyl]-methoxyphosphoryl]-1H-indole-2-carboxamide (PubChem CID 127032006) has the molecular formula C18H14ClN4O3P and a molecular weight of 400.76 g/mol. Its IUPAC name is 5-chloro-3-[[5-[(E)-2-cyanoethenyl]-3-pyridinyl]-methoxyphosphoryl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-3-[[5-[(E)-2-cyanoethenyl]-3-pyridinyl]-methoxyphosphoryl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 127032006 |
| Molecular Formula | C18H14ClN4O3P |
| Molecular Weight | 400.76 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | 5-chloro-3-[[5-[(E)-2-cyanoethenyl]-3-pyridinyl]-methoxyphosphoryl]-1H-indole-2-carboxamide |
| SMILES | COP(=O)(c1cncc(/C=C/C#N)c1)c1c(C(N)=O)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C18H14ClN4O3P/c1-26-27(25,13-7-11(3-2-6-20)9-22-10-13)17-14-8-12(19)4-5-15(14)23-16(17)18(21)24/h2-5,7-10,23H,1H3,(H2,21,24)/b3-2+ |
| InChIKey | CSQUHLARDNIBRS-NSCUHMNNSA-N |
| XLogP | 2.73 |
| TPSA | 121.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.76 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|