C19H15ClN3O2P — CID 143230453
5-chloro-3-[[3-[(E)-2-cyanoethenyl]phenyl]-methoxyphosphanyl]-1H-indole-2-carboxamide (PubChem CID 143230453) has the molecular formula C19H15ClN3O2P and a molecular weight of 383.78 g/mol. Its IUPAC name is 5-chloro-3-[[3-[(E)-2-cyanoethenyl]phenyl]-methoxyphosphanyl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-3-[[3-[(E)-2-cyanoethenyl]phenyl]-methoxyphosphanyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 143230453 |
| Molecular Formula | C19H15ClN3O2P |
| Molecular Weight | 383.78 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 5-chloro-3-[[3-[(E)-2-cyanoethenyl]phenyl]-methoxyphosphanyl]-1H-indole-2-carboxamide |
| SMILES | COP(c1cccc(/C=C/C#N)c1)c1c(C(N)=O)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C19H15ClN3O2P/c1-25-26(14-6-2-4-12(10-14)5-3-9-21)18-15-11-13(20)7-8-16(15)23-17(18)19(22)24/h2-8,10-11,23H,1H3,(H2,22,24)/b5-3+ |
| InChIKey | QHPFCDKRJIQSED-HWKANZROSA-N |
| XLogP | 3.45 |
| TPSA | 91.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.78 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|