C25H25ClN3OP — CID 67258173
5-chloro-3-[(1R)-3-(2-cyanoethenyl)-2-methyl-2-(3-methylphenyl)phosphinan-1-yl]-1H-indole-2-carboxamide (PubChem CID 67258173) has the molecular formula C25H25ClN3OP and a molecular weight of 449.92 g/mol. Its IUPAC name is 5-chloro-3-[(1R)-3-(2-cyanoethenyl)-2-methyl-2-(3-methylphenyl)phosphinan-1-yl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-3-[(1R)-3-(2-cyanoethenyl)-2-methyl-2-(3-methylphenyl)phosphinan-1-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 67258173 |
| Molecular Formula | C25H25ClN3OP |
| Molecular Weight | 449.92 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 5-chloro-3-[(1R)-3-(2-cyanoethenyl)-2-methyl-2-(3-methylphenyl)phosphinan-1-yl]-1H-indole-2-carboxamide |
| SMILES | Cc1cccc(C2(C)C(C=CC#N)CCC[P@@]2c2c(C(N)=O)[nH]c3ccc(Cl)cc23)c1 |
| InChI | InChI=1S/C25H25ClN3OP/c1-16-6-3-7-18(14-16)25(2)17(8-4-12-27)9-5-13-31(25)23-20-15-19(26)10-11-21(20)29-22(23)24(28)30/h3-4,6-8,10-11,14-15,17,29H,5,9,13H2,1-2H3,(H2,28,30)/t17?,25?,31-/m0/s1 |
| InChIKey | BVBXWELLJDPXMG-HCQCMHSZSA-N |
| XLogP | 5.74 |
| TPSA | 82.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.92 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|