C17H15ClN2O3S — CID 506872
5-chloro-3-(2,4-dimethylphenyl)sulfonyl-1H-indole-2-carboxamide (PubChem CID 506872) has the molecular formula C17H15ClN2O3S and a molecular weight of 362.84 g/mol. Its IUPAC name is 5-chloro-3-(2,4-dimethylphenyl)sulfonyl-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-3-(2,4-dimethylphenyl)sulfonyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 506872 |
| Molecular Formula | C17H15ClN2O3S |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | 5-chloro-3-(2,4-dimethylphenyl)sulfonyl-1H-indole-2-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)c2c(C(N)=O)[nH]c3ccc(Cl)cc23)c(C)c1 |
| InChI | InChI=1S/C17H15ClN2O3S/c1-9-3-6-14(10(2)7-9)24(22,23)16-12-8-11(18)4-5-13(12)20-15(16)17(19)21/h3-8,20H,1-2H3,(H2,19,21) |
| InChIKey | DVKJMWLZPHIJIH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |