C12H14ClN3O4S — CID 90709499
5-chloro-3-(3-hydroxypropylsulfamoyl)-1H-indole-2-carboxamide (PubChem CID 90709499) has the molecular formula C12H14ClN3O4S and a molecular weight of 331.78 g/mol. Its IUPAC name is 5-chloro-3-(3-hydroxypropylsulfamoyl)-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-3-(3-hydroxypropylsulfamoyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 90709499 |
| Molecular Formula | C12H14ClN3O4S |
| Molecular Weight | 331.78 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 5-chloro-3-(3-hydroxypropylsulfamoyl)-1H-indole-2-carboxamide |
| SMILES | NC(=O)c1[nH]c2ccc(Cl)cc2c1S(=O)(=O)NCCCO |
| InChI | InChI=1S/C12H14ClN3O4S/c13-7-2-3-9-8(6-7)11(10(16-9)12(14)18)21(19,20)15-4-1-5-17/h2-3,6,15-17H,1,4-5H2,(H2,14,18) |
| InChIKey | DYFROHNPIPBOCX-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 125.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.78 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|