C18H19BrN4O4S — CID 10073258
5-bromo-3-[2-(4-methoxyanilino)ethylsulfamoyl]-1H-indole-2-carboxamide (PubChem CID 10073258) has the molecular formula C18H19BrN4O4S and a molecular weight of 467.35 g/mol. Its IUPAC name is 5-bromo-3-[2-(4-methoxyanilino)ethylsulfamoyl]-1H-indole-2-carboxamide.
| Compound Name | 5-bromo-3-[2-(4-methoxyanilino)ethylsulfamoyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 10073258 |
| Molecular Formula | C18H19BrN4O4S |
| Molecular Weight | 467.35 g/mol |
| Exact Mass | 466.03 |
| IUPAC Name | 5-bromo-3-[2-(4-methoxyanilino)ethylsulfamoyl]-1H-indole-2-carboxamide |
| SMILES | COc1ccc(NCCNS(=O)(=O)c2c(C(N)=O)[nH]c3ccc(Br)cc23)cc1 |
| InChI | InChI=1S/C18H19BrN4O4S/c1-27-13-5-3-12(4-6-13)21-8-9-22-28(25,26)17-14-10-11(19)2-7-15(14)23-16(17)18(20)24/h2-7,10,21-23H,8-9H2,1H3,(H2,20,24) |
| InChIKey | JBXCMFCPQPFLPI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 126.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|