C13H12BrN3O4S — CID 10340089
5-bromo-3-(6-oxa-3-azabicyclo[3.1.0]hexan-3-ylsulfonyl)-1H-indole-2-carboxamide (PubChem CID 10340089) has the molecular formula C13H12BrN3O4S and a molecular weight of 386.23 g/mol. Its IUPAC name is 5-bromo-3-(6-oxa-3-azabicyclo[3.1.0]hexan-3-ylsulfonyl)-1H-indole-2-carboxamide.
| Compound Name | 5-bromo-3-(6-oxa-3-azabicyclo[3.1.0]hexan-3-ylsulfonyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 10340089 |
| Molecular Formula | C13H12BrN3O4S |
| Molecular Weight | 386.23 g/mol |
| Exact Mass | 384.97 |
| IUPAC Name | 5-bromo-3-(6-oxa-3-azabicyclo[3.1.0]hexan-3-ylsulfonyl)-1H-indole-2-carboxamide |
| SMILES | NC(=O)c1[nH]c2ccc(Br)cc2c1S(=O)(=O)N1CC2OC2C1 |
| InChI | InChI=1S/C13H12BrN3O4S/c14-6-1-2-8-7(3-6)12(11(16-8)13(15)18)22(19,20)17-4-9-10(5-17)21-9/h1-3,9-10,16H,4-5H2,(H2,15,18) |
| InChIKey | YAZODJZPIFLLJL-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 108.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.23 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|