C18H18Br2N4O6S2 — CID 10348762
5-bromo-3-[2-[(5-bromo-2-methoxyphenyl)sulfonylamino]ethylsulfamoyl]-1H-indole-2-carboxamide (PubChem CID 10348762) has the molecular formula C18H18Br2N4O6S2 and a molecular weight of 610.31 g/mol. Its IUPAC name is 5-bromo-3-[2-[(5-bromo-2-methoxyphenyl)sulfonylamino]ethylsulfamoyl]-1H-indole-2-carboxamide.
| Compound Name | 5-bromo-3-[2-[(5-bromo-2-methoxyphenyl)sulfonylamino]ethylsulfamoyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 10348762 |
| Molecular Formula | C18H18Br2N4O6S2 |
| Molecular Weight | 610.31 g/mol |
| Exact Mass | 607.90 |
| IUPAC Name | 5-bromo-3-[2-[(5-bromo-2-methoxyphenyl)sulfonylamino]ethylsulfamoyl]-1H-indole-2-carboxamide |
| SMILES | COc1ccc(Br)cc1S(=O)(=O)NCCNS(=O)(=O)c1c(C(N)=O)[nH]c2ccc(Br)cc12 |
| InChI | InChI=1S/C18H18Br2N4O6S2/c1-30-14-5-3-11(20)9-15(14)31(26,27)22-6-7-23-32(28,29)17-12-8-10(19)2-4-13(12)24-16(17)18(21)25/h2-5,8-9,22-24H,6-7H2,1H3,(H2,21,25) |
| InChIKey | WYTCWCKOWJLAKW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 160.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|