C10H14BrNO4S2 — CID 113237489
5-bromo-2-methoxy-N-(2-methylsulfinylethyl)benzenesulfonamide (PubChem CID 113237489) has the molecular formula C10H14BrNO4S2 and a molecular weight of 356.26 g/mol. Its IUPAC name is 5-bromo-2-methoxy-N-(2-methylsulfinylethyl)benzenesulfonamide.
| Compound Name | 5-bromo-2-methoxy-N-(2-methylsulfinylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 113237489 |
| Molecular Formula | C10H14BrNO4S2 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 354.95 |
| IUPAC Name | 5-bromo-2-methoxy-N-(2-methylsulfinylethyl)benzenesulfonamide |
| SMILES | COc1ccc(Br)cc1S(=O)(=O)NCCS(C)=O |
| InChI | InChI=1S/C10H14BrNO4S2/c1-16-9-4-3-8(11)7-10(9)18(14,15)12-5-6-17(2)13/h3-4,7,12H,5-6H2,1-2H3 |
| InChIKey | CMVFZQVQXDOKLS-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |