C12H17BrN2O4S — CID 17428914
2-[(5-bromo-2-methoxyphenyl)sulfonylamino]-N-propylacetamide (PubChem CID 17428914) has the molecular formula C12H17BrN2O4S and a molecular weight of 365.25 g/mol. Its IUPAC name is 2-[(5-bromo-2-methoxyphenyl)sulfonylamino]-N-propylacetamide.
| Compound Name | 2-[(5-bromo-2-methoxyphenyl)sulfonylamino]-N-propylacetamide |
|---|---|
| PubChem CID | 17428914 |
| Molecular Formula | C12H17BrN2O4S |
| Molecular Weight | 365.25 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | 2-[(5-bromo-2-methoxyphenyl)sulfonylamino]-N-propylacetamide |
| SMILES | CCCNC(=O)CNS(=O)(=O)c1cc(Br)ccc1OC |
| InChI | InChI=1S/C12H17BrN2O4S/c1-3-6-14-12(16)8-15-20(17,18)11-7-9(13)4-5-10(11)19-2/h4-5,7,15H,3,6,8H2,1-2H3,(H,14,16) |
| InChIKey | HMQWCGMZBAXDCT-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.25 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |