C10H13BrN2O4S — CID 8505522
N'-(5-bromo-2-methoxyphenyl)sulfonylpropanehydrazide (PubChem CID 8505522) has the molecular formula C10H13BrN2O4S and a molecular weight of 337.20 g/mol. Its IUPAC name is N'-(5-bromo-2-methoxyphenyl)sulfonylpropanehydrazide.
| Compound Name | N'-(5-bromo-2-methoxyphenyl)sulfonylpropanehydrazide |
|---|---|
| PubChem CID | 8505522 |
| Molecular Formula | C10H13BrN2O4S |
| Molecular Weight | 337.20 g/mol |
| Exact Mass | 335.98 |
| IUPAC Name | N'-(5-bromo-2-methoxyphenyl)sulfonylpropanehydrazide |
| SMILES | CCC(=O)NNS(=O)(=O)c1cc(Br)ccc1OC |
| InChI | InChI=1S/C10H13BrN2O4S/c1-3-10(14)12-13-18(15,16)9-6-7(11)4-5-8(9)17-2/h4-6,13H,3H2,1-2H3,(H,12,14) |
| InChIKey | IRGNLXZJIKOQBO-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.20 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|