C14H13BrN2O4S — CID 26966791
N'-(5-bromo-2-methoxyphenyl)sulfonylbenzohydrazide (PubChem CID 26966791) has the molecular formula C14H13BrN2O4S and a molecular weight of 385.24 g/mol. Its IUPAC name is N'-(5-bromo-2-methoxyphenyl)sulfonylbenzohydrazide.
| Compound Name | N'-(5-bromo-2-methoxyphenyl)sulfonylbenzohydrazide |
|---|---|
| PubChem CID | 26966791 |
| Molecular Formula | C14H13BrN2O4S |
| Molecular Weight | 385.24 g/mol |
| Exact Mass | 383.98 |
| IUPAC Name | N'-(5-bromo-2-methoxyphenyl)sulfonylbenzohydrazide |
| SMILES | COc1ccc(Br)cc1S(=O)(=O)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H13BrN2O4S/c1-21-12-8-7-11(15)9-13(12)22(19,20)17-16-14(18)10-5-3-2-4-6-10/h2-9,17H,1H3,(H,16,18) |
| InChIKey | YKCDZCAIHQQFAP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.24 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|