C12H17BrN2O3S — CID 8518022
N'-(5-bromo-2-methylphenyl)sulfonyl-3-methylbutanehydrazide (PubChem CID 8518022) has the molecular formula C12H17BrN2O3S and a molecular weight of 349.25 g/mol. Its IUPAC name is N'-(5-bromo-2-methylphenyl)sulfonyl-3-methylbutanehydrazide.
| Compound Name | N'-(5-bromo-2-methylphenyl)sulfonyl-3-methylbutanehydrazide |
|---|---|
| PubChem CID | 8518022 |
| Molecular Formula | C12H17BrN2O3S |
| Molecular Weight | 349.25 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | N'-(5-bromo-2-methylphenyl)sulfonyl-3-methylbutanehydrazide |
| SMILES | Cc1ccc(Br)cc1S(=O)(=O)NNC(=O)CC(C)C |
| InChI | InChI=1S/C12H17BrN2O3S/c1-8(2)6-12(16)14-15-19(17,18)11-7-10(13)5-4-9(11)3/h4-5,7-8,15H,6H2,1-3H3,(H,14,16) |
| InChIKey | MCUPMGNSWNLOAI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.25 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|