C13H12BrN3O3S — CID 8511867
N'-(5-bromo-2-methylphenyl)sulfonylpyridine-2-carbohydrazide (PubChem CID 8511867) has the molecular formula C13H12BrN3O3S and a molecular weight of 370.23 g/mol. Its IUPAC name is N'-(5-bromo-2-methylphenyl)sulfonylpyridine-2-carbohydrazide.
| Compound Name | N'-(5-bromo-2-methylphenyl)sulfonylpyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 8511867 |
| Molecular Formula | C13H12BrN3O3S |
| Molecular Weight | 370.23 g/mol |
| Exact Mass | 368.98 |
| IUPAC Name | N'-(5-bromo-2-methylphenyl)sulfonylpyridine-2-carbohydrazide |
| SMILES | Cc1ccc(Br)cc1S(=O)(=O)NNC(=O)c1ccccn1 |
| InChI | InChI=1S/C13H12BrN3O3S/c1-9-5-6-10(14)8-12(9)21(19,20)17-16-13(18)11-4-2-3-7-15-11/h2-8,17H,1H3,(H,16,18) |
| InChIKey | GNBHLAYSVJVRCX-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.23 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|