C22H19BrN4O2 — CID 58712842
N-[4-bromo-2-[[(E)-(3,4-dimethylphenyl)methylideneamino]carbamoyl]phenyl]pyridine-2-carboxamide (PubChem CID 58712842) has the molecular formula C22H19BrN4O2 and a molecular weight of 451.32 g/mol. Its IUPAC name is N-[4-bromo-2-[[(E)-(3,4-dimethylphenyl)methylideneamino]carbamoyl]phenyl]pyridine-2-carboxamide.
| Compound Name | N-[4-bromo-2-[[(E)-(3,4-dimethylphenyl)methylideneamino]carbamoyl]phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 58712842 |
| Molecular Formula | C22H19BrN4O2 |
| Molecular Weight | 451.32 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | N-[4-bromo-2-[[(E)-(3,4-dimethylphenyl)methylideneamino]carbamoyl]phenyl]pyridine-2-carboxamide |
| SMILES | Cc1ccc(/C=N/NC(=O)c2cc(Br)ccc2NC(=O)c2ccccn2)cc1C |
| InChI | InChI=1S/C22H19BrN4O2/c1-14-6-7-16(11-15(14)2)13-25-27-21(28)18-12-17(23)8-9-19(18)26-22(29)20-5-3-4-10-24-20/h3-13H,1-2H3,(H,26,29)(H,27,28)/b25-13+ |
| InChIKey | MDYGOMPHAHSLSL-DHRITJCHSA-N |
| XLogP | 4.48 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.32 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|