C34H40BrN5O2 — CID 66637764
5-bromo-N-[(3,4-dimethylphenyl)methylideneamino]-2-[[4-[(4-piperidin-1-ylpiperidin-1-yl)methyl]benzoyl]amino]benzamide (PubChem CID 66637764) has the molecular formula C34H40BrN5O2 and a molecular weight of 630.63 g/mol. Its IUPAC name is 5-bromo-N-[(3,4-dimethylphenyl)methylideneamino]-2-[[4-[(4-piperidin-1-ylpiperidin-1-yl)methyl]benzoyl]amino]benzamide.
| Compound Name | 5-bromo-N-[(3,4-dimethylphenyl)methylideneamino]-2-[[4-[(4-piperidin-1-ylpiperidin-1-yl)methyl]benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 66637764 |
| Molecular Formula | C34H40BrN5O2 |
| Molecular Weight | 630.63 g/mol |
| Exact Mass | 629.24 |
| IUPAC Name | 5-bromo-N-[(3,4-dimethylphenyl)methylideneamino]-2-[[4-[(4-piperidin-1-ylpiperidin-1-yl)methyl]benzoyl]amino]benzamide |
| SMILES | Cc1ccc(C=NNC(=O)c2cc(Br)ccc2NC(=O)c2ccc(CN3CCC(N4CCCCC4)CC3)cc2)cc1C |
| InChI | InChI=1S/C34H40BrN5O2/c1-24-6-7-27(20-25(24)2)22-36-38-34(42)31-21-29(35)12-13-32(31)37-33(41)28-10-8-26(9-11-28)23-39-18-14-30(15-19-39)40-16-4-3-5-17-40/h6-13,20-22,30H,3-5,14-19,23H2,1-2H3,(H,37,41)(H,38,42) |
| InChIKey | QCGWTUKHKJBGQW-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.63 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|