C31H37BrN6O2 — CID 58712828
5-bromo-2-[[4-[[(1,2-diethylpyrazolidin-4-yl)amino]methyl]benzoyl]amino]-N-[(E)-(3,4-dimethylphenyl)methylideneamino]benzamide (PubChem CID 58712828) has the molecular formula C31H37BrN6O2 and a molecular weight of 605.58 g/mol. Its IUPAC name is 5-bromo-2-[[4-[[(1,2-diethylpyrazolidin-4-yl)amino]methyl]benzoyl]amino]-N-[(E)-(3,4-dimethylphenyl)methylideneamino]benzamide.
| Compound Name | 5-bromo-2-[[4-[[(1,2-diethylpyrazolidin-4-yl)amino]methyl]benzoyl]amino]-N-[(E)-(3,4-dimethylphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 58712828 |
| Molecular Formula | C31H37BrN6O2 |
| Molecular Weight | 605.58 g/mol |
| Exact Mass | 604.22 |
| IUPAC Name | 5-bromo-2-[[4-[[(1,2-diethylpyrazolidin-4-yl)amino]methyl]benzoyl]amino]-N-[(E)-(3,4-dimethylphenyl)methylideneamino]benzamide |
| SMILES | CCN1CC(NCc2ccc(C(=O)Nc3ccc(Br)cc3C(=O)N/N=C/c3ccc(C)c(C)c3)cc2)CN1CC |
| InChI | InChI=1S/C31H37BrN6O2/c1-5-37-19-27(20-38(37)6-2)33-17-23-9-11-25(12-10-23)30(39)35-29-14-13-26(32)16-28(29)31(40)36-34-18-24-8-7-21(3)22(4)15-24/h7-16,18,27,33H,5-6,17,19-20H2,1-4H3,(H,35,39)(H,36,40)/b34-18+ |
| InChIKey | RKYFGXVTAOOYCV-FABQOPTDSA-N |
| XLogP | 5.11 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.58 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|