C30H33BrN4O3 — CID 23107901
5-bromo-2-[[4-[[4-(2-hydroxyethyl)piperidin-1-yl]methyl]benzoyl]amino]-N-[(E)-(4-methylphenyl)methylideneamino]benzamide (PubChem CID 23107901) has the molecular formula C30H33BrN4O3 and a molecular weight of 577.52 g/mol. Its IUPAC name is 5-bromo-2-[[4-[[4-(2-hydroxyethyl)piperidin-1-yl]methyl]benzoyl]amino]-N-[(E)-(4-methylphenyl)methylideneamino]benzamide.
| Compound Name | 5-bromo-2-[[4-[[4-(2-hydroxyethyl)piperidin-1-yl]methyl]benzoyl]amino]-N-[(E)-(4-methylphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 23107901 |
| Molecular Formula | C30H33BrN4O3 |
| Molecular Weight | 577.52 g/mol |
| Exact Mass | 576.17 |
| IUPAC Name | 5-bromo-2-[[4-[[4-(2-hydroxyethyl)piperidin-1-yl]methyl]benzoyl]amino]-N-[(E)-(4-methylphenyl)methylideneamino]benzamide |
| SMILES | Cc1ccc(/C=N/NC(=O)c2cc(Br)ccc2NC(=O)c2ccc(CN3CCC(CCO)CC3)cc2)cc1 |
| InChI | InChI=1S/C30H33BrN4O3/c1-21-2-4-23(5-3-21)19-32-34-30(38)27-18-26(31)10-11-28(27)33-29(37)25-8-6-24(7-9-25)20-35-15-12-22(13-16-35)14-17-36/h2-11,18-19,22,36H,12-17,20H2,1H3,(H,33,37)(H,34,38)/b32-19+ |
| InChIKey | CHCZYCMXSGFCMY-BIZUNTBRSA-N |
| XLogP | 5.37 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.52 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|