C29H32BrN5O3 — CID 23107761
5-bromo-N-[(E)-(4-methylphenyl)methylideneamino]-2-[[4-[(2-morpholin-4-ylethylamino)methyl]benzoyl]amino]benzamide (PubChem CID 23107761) has the molecular formula C29H32BrN5O3 and a molecular weight of 578.51 g/mol. Its IUPAC name is 5-bromo-N-[(E)-(4-methylphenyl)methylideneamino]-2-[[4-[(2-morpholin-4-ylethylamino)methyl]benzoyl]amino]benzamide.
| Compound Name | 5-bromo-N-[(E)-(4-methylphenyl)methylideneamino]-2-[[4-[(2-morpholin-4-ylethylamino)methyl]benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 23107761 |
| Molecular Formula | C29H32BrN5O3 |
| Molecular Weight | 578.51 g/mol |
| Exact Mass | 577.17 |
| IUPAC Name | 5-bromo-N-[(E)-(4-methylphenyl)methylideneamino]-2-[[4-[(2-morpholin-4-ylethylamino)methyl]benzoyl]amino]benzamide |
| SMILES | Cc1ccc(/C=N/NC(=O)c2cc(Br)ccc2NC(=O)c2ccc(CNCCN3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C29H32BrN5O3/c1-21-2-4-23(5-3-21)20-32-34-29(37)26-18-25(30)10-11-27(26)33-28(36)24-8-6-22(7-9-24)19-31-12-13-35-14-16-38-17-15-35/h2-11,18,20,31H,12-17,19H2,1H3,(H,33,36)(H,34,37)/b32-20+ |
| InChIKey | FQPZEIMKKDAMLY-UZWMFBFFSA-N |
| XLogP | 4.20 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|