C30H33BrN4O3 — CID 23108160
5-bromo-N-[(E)-(3,4-dimethylphenyl)methylideneamino]-2-[[4-[[4-(hydroxymethyl)piperidin-1-yl]methyl]benzoyl]amino]benzamide (PubChem CID 23108160) has the molecular formula C30H33BrN4O3 and a molecular weight of 577.52 g/mol. Its IUPAC name is 5-bromo-N-[(E)-(3,4-dimethylphenyl)methylideneamino]-2-[[4-[[4-(hydroxymethyl)piperidin-1-yl]methyl]benzoyl]amino]benzamide.
| Compound Name | 5-bromo-N-[(E)-(3,4-dimethylphenyl)methylideneamino]-2-[[4-[[4-(hydroxymethyl)piperidin-1-yl]methyl]benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 23108160 |
| Molecular Formula | C30H33BrN4O3 |
| Molecular Weight | 577.52 g/mol |
| Exact Mass | 576.17 |
| IUPAC Name | 5-bromo-N-[(E)-(3,4-dimethylphenyl)methylideneamino]-2-[[4-[[4-(hydroxymethyl)piperidin-1-yl]methyl]benzoyl]amino]benzamide |
| SMILES | Cc1ccc(/C=N/NC(=O)c2cc(Br)ccc2NC(=O)c2ccc(CN3CCC(CO)CC3)cc2)cc1C |
| InChI | InChI=1S/C30H33BrN4O3/c1-20-3-4-24(15-21(20)2)17-32-34-30(38)27-16-26(31)9-10-28(27)33-29(37)25-7-5-22(6-8-25)18-35-13-11-23(19-36)12-14-35/h3-10,15-17,23,36H,11-14,18-19H2,1-2H3,(H,33,37)(H,34,38)/b32-17+ |
| InChIKey | HWWDSMCEAVFMCY-VTNSRFBWSA-N |
| XLogP | 5.29 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.52 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|