C12H16BrNO4S — CID 113219262
methyl 3-[(5-bromo-2-methylphenyl)sulfonylamino]butanoate (PubChem CID 113219262) has the molecular formula C12H16BrNO4S and a molecular weight of 350.23 g/mol. Its IUPAC name is methyl 3-[(5-bromo-2-methylphenyl)sulfonylamino]butanoate.
| Compound Name | methyl 3-[(5-bromo-2-methylphenyl)sulfonylamino]butanoate |
|---|---|
| PubChem CID | 113219262 |
| Molecular Formula | C12H16BrNO4S |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | methyl 3-[(5-bromo-2-methylphenyl)sulfonylamino]butanoate |
| SMILES | COC(=O)CC(C)NS(=O)(=O)c1cc(Br)ccc1C |
| InChI | InChI=1S/C12H16BrNO4S/c1-8-4-5-10(13)7-11(8)19(16,17)14-9(2)6-12(15)18-3/h4-5,7,9,14H,6H2,1-3H3 |
| InChIKey | IBPPYRIFACYCKM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |