C11H12BrNO7S — CID 78907344
2-[(5-bromo-2-methoxyphenyl)sulfonylamino]butanedioic acid (PubChem CID 78907344) has the molecular formula C11H12BrNO7S and a molecular weight of 382.19 g/mol. Its IUPAC name is 2-[(5-bromo-2-methoxyphenyl)sulfonylamino]butanedioic acid.
| Compound Name | 2-[(5-bromo-2-methoxyphenyl)sulfonylamino]butanedioic acid |
|---|---|
| PubChem CID | 78907344 |
| Molecular Formula | C11H12BrNO7S |
| Molecular Weight | 382.19 g/mol |
| Exact Mass | 380.95 |
| IUPAC Name | 2-[(5-bromo-2-methoxyphenyl)sulfonylamino]butanedioic acid |
| SMILES | COc1ccc(Br)cc1S(=O)(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H12BrNO7S/c1-20-8-3-2-6(12)4-9(8)21(18,19)13-7(11(16)17)5-10(14)15/h2-4,7,13H,5H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | YVPSURSOTPWFIX-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.19 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |