C21H29BN4O6S — CID 89028502
CID 89028502 (PubChem CID 89028502) has the molecular formula C21H29BN4O6S and a molecular weight of 476.36 g/mol.
| Compound Name | CID 89028502 |
|---|---|
| PubChem CID | 89028502 |
| Molecular Formula | C21H29BN4O6S |
| Molecular Weight | 476.36 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2[nH]c(C(N)=O)c(S(=O)(=O)N3CCOC(C(=O)NCCCOCCCC)C3)c2c1 |
| InChI | InChI=1S/C21H29BN4O6S/c1-2-3-9-31-10-4-7-24-21(28)17-13-26(8-11-32-17)33(29,30)19-15-12-14(22)5-6-16(15)25-18(19)20(23)27/h5-6,12,17,25H,2-4,7-11,13H2,1H3,(H2,23,27)(H,24,28) |
| InChIKey | UGKGGXKOBXIQMF-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 143.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.36 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|