About CID 89028502
CID 89028502 (PubChem CID 89028502) has the molecular formula C21H29BN4O6S
and a molecular weight of 476.36 g/mol.
Molecular Properties
| Compound Name | CID 89028502 |
| PubChem CID | 89028502 |
| Molecular Formula | C21H29BN4O6S |
| Molecular Weight | 476.36 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2[nH]c(C(N)=O)c(S(=O)(=O)N3CCOC(C(=O)NCCCOCCCC)C3)c2c1 |
| InChI | InChI=1S/C21H29BN4O6S/c1-2-3-9-31-10-4-7-24-21(28)17-13-26(8-11-32-17)33(29,30)19-15-12-14(22)5-6-16(15)25-18(19)20(23)27/h5-6,12,17,25H,2-4,7-11,13H2,1H3,(H2,23,27)(H,24,28) |
| InChIKey | UGKGGXKOBXIQMF-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 143.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 476.36 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 89028502 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89028502?
The IUPAC name of CID 89028502 (CID 89028502) is not available.
What is the SMILES notation for CID 89028502?
The canonical SMILES for CID 89028502 is [B]c1ccc2[nH]c(C(N)=O)c(S(=O)(=O)N3CCOC(C(=O)NCCCOCCCC)C3)c2c1.
What is the InChIKey of CID 89028502?
The InChIKey is UGKGGXKOBXIQMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29BN4O6S/c1-2-3-9-31-10-4-7-24-21(28)17-13-26(8-11-32-17)33(29,30)19-15-12-14(22)5-6-16(15)25-18(19)20(23)27/h5-6,12,17,25H,2-4,7-11,13H2,1H3,(H2,23,27)(H,24,28).
What are the key properties of CID 89028502?
CID 89028502 has a molecular weight of 476.36 g/mol, XLogP of -0.23, 11 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89028502 is sourced from PubChem (CID 89028502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).